Products 1554588-19-0
CAS 1554588-19-0 is the registry number for 6-Oxo-octahydro-1H-indene-3a-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-oxo-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylic acid (CAS 1554588-19-0) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: 6-oxo-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylic acid. InChIKey: PSINJGYRAIKJBP-UHFFFAOYSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 6-oxo-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylic acid |
| InChIKey | PSINJGYRAIKJBP-UHFFFAOYSA-N |
| SMILES | C1CC2CC(=O)CCC2(C1)C(=O)O |
Computed by PubChem (NCBI)