Products 1554650-83-7
CAS 1554650-83-7 appears in our catalog under these names: 4-(Oxetan-3-yl)benzoic acid, 95%, 4-(Oxetan-3-yl)benzoic acid, 98%, 4-(Oxetan-3-yl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
4-(oxetan-3-yl)benzoic acid (CAS 1554650-83-7) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 4-(oxetan-3-yl)benzoic acid. InChIKey: ULDXRIXPOPDPMR-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 4-(oxetan-3-yl)benzoic acid |
| InChIKey | ULDXRIXPOPDPMR-UHFFFAOYSA-N |
| SMILES | C1C(CO1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)