CAS 155528-92-0 is the registry number for Deferasirox Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chlorophenyl)-1,3-benzoxazin-4-one (CAS 155528-92-0) is a chemical compound with the molecular formula C14H8ClNO2 and a molecular weight of 257.67 g/mol. IUPAC name: 2-(2-chlorophenyl)-1,3-benzoxazin-4-one. InChIKey: WLXFQHOQUZLFCM-UHFFFAOYSA-N.
| Molecular formula | C14H8ClNO2 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1,3-benzoxazin-4-one |
| InChIKey | WLXFQHOQUZLFCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N=C(O2)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)