CAS 32729-66-1 is the registry number for (5-Chlorobenzo(d)oxazol-2-yl)(phenyl)methanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
(5-chloro-1,3-benzoxazol-2-yl)-phenylmethanone (CAS 32729-66-1) is a chemical compound with the molecular formula C14H8ClNO2 and a molecular weight of 257.67 g/mol. IUPAC name: (5-chloro-1,3-benzoxazol-2-yl)-phenylmethanone. InChIKey: IONKMHKUNKOKBO-UHFFFAOYSA-N.
| Molecular formula | C14H8ClNO2 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | (5-chloro-1,3-benzoxazol-2-yl)-phenylmethanone |
| InChIKey | IONKMHKUNKOKBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=NC3=C(O2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)