CAS 1267406-76-7 is the registry number for 2-(3-Chlorophenyl)benzo[d]oxazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chlorophenyl)-1,3-benzoxazole-5-carbaldehyde (CAS 1267406-76-7) is a chemical compound with the molecular formula C14H8ClNO2 and a molecular weight of 257.67 g/mol. IUPAC name: 2-(3-chlorophenyl)-1,3-benzoxazole-5-carbaldehyde. InChIKey: NSZGXFSPEWIZLC-UHFFFAOYSA-N.
| Molecular formula | C14H8ClNO2 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1,3-benzoxazole-5-carbaldehyde |
| InChIKey | NSZGXFSPEWIZLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC3=C(O2)C=CC(=C3)C=O |
Computed by PubChem (NCBI)