Products 1355247-06-1

CAS 1355247-06-1 is the registry number for 3-(3-Chloro-4-cyanophenyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-(3-chloro-4-cyanophenyl)benzoic acid (CAS 1355247-06-1) is a chemical compound with the molecular formula C14H8ClNO2 and a molecular weight of 257.67 g/mol. IUPAC name: 3-(3-chloro-4-cyanophenyl)benzoic acid. InChIKey: MUZFISYMSYFCBF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8ClNO2
Molecular weight257.67 g/mol
IUPAC name3-(3-chloro-4-cyanophenyl)benzoic acid
InChIKeyMUZFISYMSYFCBF-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)C2=CC(=C(C=C2)C#N)Cl

Computed by PubChem (NCBI)