CAS 155538-41-3 is the registry number for 2-Amino-6-chloro-4-(trifluoromethyl)benzo[d]thiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-chloro-4-(trifluoromethyl)-1,3-benzothiazol-2-amine (CAS 155538-41-3) is a chemical compound with the molecular formula C8H4ClF3N2S and a molecular weight of 252.64 g/mol. IUPAC name: 6-chloro-4-(trifluoromethyl)-1,3-benzothiazol-2-amine. InChIKey: DHURNZDLDZXODT-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3N2S |
|---|---|
| Molecular weight | 252.64 g/mol |
| IUPAC name | 6-chloro-4-(trifluoromethyl)-1,3-benzothiazol-2-amine |
| InChIKey | DHURNZDLDZXODT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1C(F)(F)F)N=C(S2)N)Cl |
Computed by PubChem (NCBI)