CAS 1628317-85-0 appears in our catalog under these names: 4-Chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine, 95%, 4-Chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine, 98%, 98%, 4-Chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
4-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine (CAS 1628317-85-0) is a chemical compound with the molecular formula C8H4ClF3N2S and a molecular weight of 252.64 g/mol. IUPAC name: 4-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine. InChIKey: DZSVALSILXNFGI-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3N2S |
|---|---|
| Molecular weight | 252.64 g/mol |
| IUPAC name | 4-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
| InChIKey | DZSVALSILXNFGI-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=NC=N2)Cl)CC(F)(F)F |
Computed by PubChem (NCBI)