CAS 1609670-88-3 is the registry number for 2-(Chloromethyl)-6-(trifluoromethyl)thiazolo(5,4-b)pyridine, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-(chloromethyl)-6-(trifluoromethyl)-[1,3]thiazolo[5,4-b]pyridine (CAS 1609670-88-3) is a chemical compound with the molecular formula C8H4ClF3N2S and a molecular weight of 252.64 g/mol. IUPAC name: 2-(chloromethyl)-6-(trifluoromethyl)-[1,3]thiazolo[5,4-b]pyridine. InChIKey: RGNNEZDCCZAVSQ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3N2S |
|---|---|
| Molecular weight | 252.64 g/mol |
| IUPAC name | 2-(chloromethyl)-6-(trifluoromethyl)-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | RGNNEZDCCZAVSQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=C(S2)CCl)C(F)(F)F |
Computed by PubChem (NCBI)