Products 1555546-92-3

CAS 1555546-92-3 is the registry number for Ethyl 2-(2-amino-1,3-thiazol-4-yl)-2,2-difluoroacetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(2-amino-1,3-thiazol-4-yl)-2,2-difluoroacetate (CAS 1555546-92-3) is a chemical compound with the molecular formula C7H8F2N2O2S and a molecular weight of 222.21 g/mol. IUPAC name: ethyl 2-(2-amino-1,3-thiazol-4-yl)-2,2-difluoroacetate. InChIKey: GDBMSRIBYRPJFM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8F2N2O2S
Molecular weight222.21 g/mol
IUPAC nameethyl 2-(2-amino-1,3-thiazol-4-yl)-2,2-difluoroacetate
InChIKeyGDBMSRIBYRPJFM-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=CSC(=N1)N)(F)F

Computed by PubChem (NCBI)