CAS 1555546-92-3 is the registry number for Ethyl 2-(2-amino-1,3-thiazol-4-yl)-2,2-difluoroacetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 2-(2-amino-1,3-thiazol-4-yl)-2,2-difluoroacetate (CAS 1555546-92-3) is a chemical compound with the molecular formula C7H8F2N2O2S and a molecular weight of 222.21 g/mol. IUPAC name: ethyl 2-(2-amino-1,3-thiazol-4-yl)-2,2-difluoroacetate. InChIKey: GDBMSRIBYRPJFM-UHFFFAOYSA-N.
| Molecular formula | C7H8F2N2O2S |
|---|---|
| Molecular weight | 222.21 g/mol |
| IUPAC name | ethyl 2-(2-amino-1,3-thiazol-4-yl)-2,2-difluoroacetate |
| InChIKey | GDBMSRIBYRPJFM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CSC(=N1)N)(F)F |
Computed by PubChem (NCBI)