CAS 4837-28-9 is the registry number for (4-Difluoromethanesulfonylphenyl)hydrazine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[4-(difluoromethylsulfonyl)phenyl]hydrazine (CAS 4837-28-9) is a chemical compound with the molecular formula C7H8F2N2O2S and a molecular weight of 222.21 g/mol. IUPAC name: [4-(difluoromethylsulfonyl)phenyl]hydrazine. InChIKey: XOJLKMODSWOANU-UHFFFAOYSA-N.
| Molecular formula | C7H8F2N2O2S |
|---|---|
| Molecular weight | 222.21 g/mol |
| IUPAC name | [4-(difluoromethylsulfonyl)phenyl]hydrazine |
| InChIKey | XOJLKMODSWOANU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NN)S(=O)(=O)C(F)F |
Computed by PubChem (NCBI)