CAS 1710293-58-5 is the registry number for Ethyl 2-amino-5-(difluoromethyl)thiazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g.
Ethyl 2-amino-5-(difluoromethyl)-1,3-thiazole-4-carboxylate (CAS 1710293-58-5) is a chemical compound with the molecular formula C7H8F2N2O2S and a molecular weight of 222.21 g/mol. IUPAC name: ethyl 2-amino-5-(difluoromethyl)-1,3-thiazole-4-carboxylate. InChIKey: XRSRBTOOXNACIG-UHFFFAOYSA-N.
| Molecular formula | C7H8F2N2O2S |
|---|---|
| Molecular weight | 222.21 g/mol |
| IUPAC name | ethyl 2-amino-5-(difluoromethyl)-1,3-thiazole-4-carboxylate |
| InChIKey | XRSRBTOOXNACIG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=N1)N)C(F)F |
Computed by PubChem (NCBI)