Products 1555987-99-9
CAS 1555987-99-9 appears in our catalog under these names: 6-Bromo-1,3-dimethylindolin-2-one, 95%, 6-Bromo-1,3-dimethylindolin-2-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
6-bromo-1,3-dimethyl-3H-indol-2-one (CAS 1555987-99-9) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 6-bromo-1,3-dimethyl-3H-indol-2-one. InChIKey: MXPJGXFVNXAQDK-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 6-bromo-1,3-dimethyl-3H-indol-2-one |
| InChIKey | MXPJGXFVNXAQDK-UHFFFAOYSA-N |
| SMILES | CC1C2=C(C=C(C=C2)Br)N(C1=O)C |
Computed by PubChem (NCBI)