Products 1556295-67-0
CAS 1556295-67-0 appears in our catalog under these names: 1-(3-Bromo-5-methoxyphenyl)dihydropyrimidine-2,4(1H,3H)-dione, 95%, 1-(3-Bromo-5-methoxyphenyl)dihydropyrimidine-2,4(1H,3H)-dione, >95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-(3-bromo-5-methoxyphenyl)-1,3-diazinane-2,4-dione (CAS 1556295-67-0) is a chemical compound with the molecular formula C11H11BrN2O3 and a molecular weight of 299.12 g/mol. IUPAC name: 1-(3-bromo-5-methoxyphenyl)-1,3-diazinane-2,4-dione. InChIKey: YZTMYOOZRPWTKM-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O3 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | 1-(3-bromo-5-methoxyphenyl)-1,3-diazinane-2,4-dione |
| InChIKey | YZTMYOOZRPWTKM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)N2CCC(=O)NC2=O)Br |
Computed by PubChem (NCBI)