CAS 15563-46-9 is the registry number for 4-Chloro-N,N-dimethyl-benzenecarbothioamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-N,N-dimethylbenzenecarbothioamide (CAS 15563-46-9) is a chemical compound with the molecular formula C9H10ClNS and a molecular weight of 199.70 g/mol. IUPAC name: 4-chloro-N,N-dimethylbenzenecarbothioamide. InChIKey: ANUVRTDELFGTRW-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNS |
|---|---|
| Molecular weight | 199.70 g/mol |
| IUPAC name | 4-chloro-N,N-dimethylbenzenecarbothioamide |
| InChIKey | ANUVRTDELFGTRW-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)