CAS 155697-42-0 appears in our catalog under these names: 3-(3-(Benzyloxy)phenyl)prop-2-en-1-ol 97%, (2E)-3-[3-(Phenylmethoxy)phenyl]-2-propen-1-ol, 97%, 97%, 3-BENZYLOXYCINNAMYL ALCOHOL, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g.
(E)-3-(3-phenylmethoxyphenyl)prop-2-en-1-ol (CAS 155697-42-0) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: (E)-3-(3-phenylmethoxyphenyl)prop-2-en-1-ol. InChIKey: QQGGFBBEVHNLKT-WEVVVXLNSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | (E)-3-(3-phenylmethoxyphenyl)prop-2-en-1-ol |
| InChIKey | QQGGFBBEVHNLKT-WEVVVXLNSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)/C=C/CO |
Computed by PubChem (NCBI)