Products 155702-14-0
CAS 155702-14-0 appears in our catalog under these names: Dimethyl 5-fluoropyridine-2,3-dicarboxylate, 95%, Dimethyl 5-fluoropyridine-2,3-dicarboxylate, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
Dimethyl 5-fluoropyridine-2,3-dicarboxylate (CAS 155702-14-0) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: dimethyl 5-fluoropyridine-2,3-dicarboxylate. InChIKey: UYCFMOIVNGROIO-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | dimethyl 5-fluoropyridine-2,3-dicarboxylate |
| InChIKey | UYCFMOIVNGROIO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)F)C(=O)OC |
Computed by PubChem (NCBI)