CAS 1557288-48-8 is the registry number for Rel-tert-butyl (2R,5R)-2-methyl-5-(o-tolyl)piperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,5R)-2-methyl-5-(2-methylphenyl)piperazine-1-carboxylate (CAS 1557288-48-8) is a chemical compound with the molecular formula C17H26N2O2 and a molecular weight of 290.4 g/mol. IUPAC name: tert-butyl (2R,5R)-2-methyl-5-(2-methylphenyl)piperazine-1-carboxylate. InChIKey: QNGABPSYAYGSHX-HIFRSBDPSA-N.
| Molecular formula | C17H26N2O2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | tert-butyl (2R,5R)-2-methyl-5-(2-methylphenyl)piperazine-1-carboxylate |
| InChIKey | QNGABPSYAYGSHX-HIFRSBDPSA-N |
| SMILES | C[C@@H]1CN[C@@H](CN1C(=O)OC(C)(C)C)C2=CC=CC=C2C |
Computed by PubChem (NCBI)