CAS 1557288-63-7 is the registry number for Rel-N,N-dimethyl-4-((3R,6S)-6-methylmorpholin-3-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-dimethyl-4-[(3R,6S)-6-methylmorpholin-3-yl]aniline (CAS 1557288-63-7) is a chemical compound with the molecular formula C13H20N2O and a molecular weight of 220.31 g/mol. IUPAC name: N,N-dimethyl-4-[(3R,6S)-6-methylmorpholin-3-yl]aniline. InChIKey: GPIAGYWFJQWGON-GWCFXTLKSA-N.
| Molecular formula | C13H20N2O |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | N,N-dimethyl-4-[(3R,6S)-6-methylmorpholin-3-yl]aniline |
| InChIKey | GPIAGYWFJQWGON-GWCFXTLKSA-N |
| SMILES | C[C@H]1CN[C@@H](CO1)C2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)