CAS 155730-92-0 appears in our catalog under these names: S-2E, 98%, S–2E, S-2E. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 25mg, 5mg, Get quote.
4-[[(3S)-1-(4-tert-butylphenyl)-5-oxopyrrolidin-3-yl]methoxy]benzoic acid (CAS 155730-92-0) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: 4-[[(3S)-1-(4-tert-butylphenyl)-5-oxopyrrolidin-3-yl]methoxy]benzoic acid. InChIKey: YZADMDZNVOBYGR-HNNXBMFYSA-N.
| Molecular formula | C22H25NO4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 4-[[(3S)-1-(4-tert-butylphenyl)-5-oxopyrrolidin-3-yl]methoxy]benzoic acid |
| InChIKey | YZADMDZNVOBYGR-HNNXBMFYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N2C[C@H](CC2=O)COC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)