CAS 1557799-39-9 appears in our catalog under these names: 1-(6-(4-Bromophenoxy)pyridin-3-yl)ethan-1-one, 95%, 5-ACetyl-2-(4-bromophenoxy) pyridine, 95%, 1-[6-(4-bromophenoxy)pyridin-3-yl]ethan-1-one, 98%, 98%, 5-Acetyl-2-(4-bromophenoxy) pyridine, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg.
1-[6-(4-bromophenoxy)-3-pyridinyl]ethanone (CAS 1557799-39-9) is a chemical compound with the molecular formula C13H10BrNO2 and a molecular weight of 292.13 g/mol. IUPAC name: 1-[6-(4-bromophenoxy)-3-pyridinyl]ethanone. InChIKey: XBDIIEFLZBEFJL-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO2 |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | 1-[6-(4-bromophenoxy)-3-pyridinyl]ethanone |
| InChIKey | XBDIIEFLZBEFJL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C(C=C1)OC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)