CAS 1558386-32-5 appears in our catalog under these names: 4-(Chloromethyl)-2-(2,3-dihydro-1-benzofuran-2-yl)pyrimidine, 95%, 4-(Chloromethyl)-2-(2,3-dihydro-1-benzofuran-2-yl)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(chloromethyl)-2-(2,3-dihydro-1-benzofuran-2-yl)pyrimidine (CAS 1558386-32-5) is a chemical compound with the molecular formula C13H11ClN2O and a molecular weight of 246.69 g/mol. IUPAC name: 4-(chloromethyl)-2-(2,3-dihydro-1-benzofuran-2-yl)pyrimidine. InChIKey: QBEDYTZKPARYQG-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(2,3-dihydro-1-benzofuran-2-yl)pyrimidine |
| InChIKey | QBEDYTZKPARYQG-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C21)C3=NC=CC(=N3)CCl |
Computed by PubChem (NCBI)