CAS 155855-51-9 appears in our catalog under these names: Ticagrelor Impurity 228, (3aS,4S,7R,7aS)-6-Benzyl-2,2-dimethyltetrahydro-4H-4,7-methano[1,3]dioxolo[4,5-d][1,2]oxazine, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg.
(1R,2S,6S,7S)-9-benzyl-4,4-dimethyl-3,5,8-trioxa-9-azatricyclo[5.2.1.02,6]decane (CAS 155855-51-9) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: (1R,2S,6S,7S)-9-benzyl-4,4-dimethyl-3,5,8-trioxa-9-azatricyclo[5.2.1.02,6]decane. InChIKey: OAALGCYGQQFZOQ-ZOBORPQBSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | (1R,2S,6S,7S)-9-benzyl-4,4-dimethyl-3,5,8-trioxa-9-azatricyclo[5.2.1.02,6]decane |
| InChIKey | OAALGCYGQQFZOQ-ZOBORPQBSA-N |
| SMILES | CC1(O[C@H]2[C@H]3C[C@@H]([C@H]2O1)ON3CC4=CC=CC=C4)C |
Computed by PubChem (NCBI)