CAS 155926-44-6 is the registry number for 2,4-Dimethyl-N,N-di-p-tolylaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dimethyl-N,N-bis(4-methylphenyl)aniline (CAS 155926-44-6) is a chemical compound with the molecular formula C22H23N and a molecular weight of 301.4 g/mol. IUPAC name: 2,4-dimethyl-N,N-bis(4-methylphenyl)aniline. InChIKey: WWEVURATWLRRNJ-UHFFFAOYSA-N.
| Molecular formula | C22H23N |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 2,4-dimethyl-N,N-bis(4-methylphenyl)aniline |
| InChIKey | WWEVURATWLRRNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2=CC=C(C=C2)C)C3=C(C=C(C=C3)C)C |
Computed by PubChem (NCBI)