CAS 161032-48-0 is the registry number for 5′-(tert-Butyl)-[1,1′:3′,1″-terphenyl]-2′-amine, 98.0%, 98.0%. Offered by: Chemat. Available pack sizes: 200mg, 1g.
4-tert-butyl-2,6-diphenylaniline (CAS 161032-48-0) is a chemical compound with the molecular formula C22H23N and a molecular weight of 301.4 g/mol. IUPAC name: 4-tert-butyl-2,6-diphenylaniline. InChIKey: QDADOVYTWGTHOZ-UHFFFAOYSA-N.
| Molecular formula | C22H23N |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 4-tert-butyl-2,6-diphenylaniline |
| InChIKey | QDADOVYTWGTHOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C2=CC=CC=C2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)