CAS 36809-23-1 is the registry number for N,N-Diphenyl-N-(4-tert-butylphenyl)amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
4-tert-butyl-N,N-diphenylaniline (CAS 36809-23-1) is a chemical compound with the molecular formula C22H23N and a molecular weight of 301.4 g/mol. IUPAC name: 4-tert-butyl-N,N-diphenylaniline. InChIKey: QAOWDDALFFRROB-UHFFFAOYSA-N.
| Molecular formula | C22H23N |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 4-tert-butyl-N,N-diphenylaniline |
| InChIKey | QAOWDDALFFRROB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)