CAS 156265-95-1 is the registry number for 4-(3,5-Difluorophenyl)cyclohexanone, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-(3,5-difluorophenyl)cyclohexan-1-one (CAS 156265-95-1) is a chemical compound with the molecular formula C12H12F2O and a molecular weight of 210.22 g/mol. IUPAC name: 4-(3,5-difluorophenyl)cyclohexan-1-one. InChIKey: LHELOYUWBUCWBE-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O |
|---|---|
| Molecular weight | 210.22 g/mol |
| IUPAC name | 4-(3,5-difluorophenyl)cyclohexan-1-one |
| InChIKey | LHELOYUWBUCWBE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CCC1C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)