Products 1602887-38-6
CAS 1602887-38-6 is the registry number for 1-(4-Cyclobutylphenyl)-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
1-(4-cyclobutylphenyl)-2,2-difluoroethanone (CAS 1602887-38-6) is a chemical compound with the molecular formula C12H12F2O and a molecular weight of 210.22 g/mol. IUPAC name: 1-(4-cyclobutylphenyl)-2,2-difluoroethanone. InChIKey: MVRWBNWTDQILAN-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O |
|---|---|
| Molecular weight | 210.22 g/mol |
| IUPAC name | 1-(4-cyclobutylphenyl)-2,2-difluoroethanone |
| InChIKey | MVRWBNWTDQILAN-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=CC=C(C=C2)C(=O)C(F)F |
Computed by PubChem (NCBI)