CAS 2381247-98-7 is the registry number for (2,2-Difluoro-3-phenylbicyclo[1.1.1]pentan-1-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,2-difluoro-3-phenyl-1-bicyclo[1.1.1]pentanyl)methanol (CAS 2381247-98-7) is a chemical compound with the molecular formula C12H12F2O and a molecular weight of 210.22 g/mol. IUPAC name: (2,2-difluoro-3-phenyl-1-bicyclo[1.1.1]pentanyl)methanol. InChIKey: NJVFIMPXNSFFSI-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O |
|---|---|
| Molecular weight | 210.22 g/mol |
| IUPAC name | (2,2-difluoro-3-phenyl-1-bicyclo[1.1.1]pentanyl)methanol |
| InChIKey | NJVFIMPXNSFFSI-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2(F)F)C3=CC=CC=C3)CO |
Computed by PubChem (NCBI)