Products 1563403-13-3
CAS 1563403-13-3 is the registry number for (2E)-3-(2,4,5-Trimethylphenyl)prop-2-en-1-ol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
(E)-3-(2,4,5-trimethylphenyl)prop-2-en-1-ol (CAS 1563403-13-3) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: (E)-3-(2,4,5-trimethylphenyl)prop-2-en-1-ol. InChIKey: XQGQYHKZVPIYIW-SNAWJCMRSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | (E)-3-(2,4,5-trimethylphenyl)prop-2-en-1-ol |
| InChIKey | XQGQYHKZVPIYIW-SNAWJCMRSA-N |
| SMILES | CC1=CC(=C(C=C1C)/C=C/CO)C |
Computed by PubChem (NCBI)