CAS 156371-85-6 appears in our catalog under these names: (S)-tert-Butyl 3-mercaptopyrrolidine-1-carboxylate, 95%, 95%, (S)-3-Mercapto-pyrrolidine-1-carboxylic acid tert-butyl ester, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Tert-butyl (3S)-3-sulfanylpyrrolidine-1-carboxylate (CAS 156371-85-6) is a chemical compound with the molecular formula C9H17NO2S and a molecular weight of 203.30 g/mol. IUPAC name: tert-butyl (3S)-3-sulfanylpyrrolidine-1-carboxylate. InChIKey: QZVCJLUVFPPQLX-ZETCQYMHSA-N.
| Molecular formula | C9H17NO2S |
|---|---|
| Molecular weight | 203.30 g/mol |
| IUPAC name | tert-butyl (3S)-3-sulfanylpyrrolidine-1-carboxylate |
| InChIKey | QZVCJLUVFPPQLX-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)S |
Computed by PubChem (NCBI)