Products 156420-67-6
CAS 156420-67-6 appears in our catalog under these names: 5-Ethyl-3-hydroxy-4-methyl-2(5H)-furanone-d3, >95% (HPLC), 5-Ethyl-3-hydroxy-4-methyl-2(5H)-furanone-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 25 mg, 50 mg, 5 mg.
4-hydroxy-3-methyl-2-(2,2,2-trideuterioethyl)-2H-furan-5-one (CAS 156420-67-6) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 145.17 g/mol. IUPAC name: 4-hydroxy-3-methyl-2-(2,2,2-trideuterioethyl)-2H-furan-5-one. InChIKey: IUFQZPBIRYFPFD-FIBGUPNXSA-N.
| Molecular formula | C7H10O3 |
|---|---|
| Molecular weight | 145.17 g/mol |
| IUPAC name | 4-hydroxy-3-methyl-2-(2,2,2-trideuterioethyl)-2H-furan-5-one |
| InChIKey | IUFQZPBIRYFPFD-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC1C(=C(C(=O)O1)O)C |
Computed by PubChem (NCBI)