CAS 1564677-76-4 is the registry number for 2-{((9H-Fluoren-9-yl)methoxy)carbonyl}-2,3-dihydro-1H-isoindole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(9H-fluoren-9-ylmethoxycarbonyl)-1,3-dihydroisoindole-5-carboxylic acid (CAS 1564677-76-4) is a chemical compound with the molecular formula C24H19NO4 and a molecular weight of 385.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonyl)-1,3-dihydroisoindole-5-carboxylic acid. InChIKey: LLDDMZGYILWGLP-UHFFFAOYSA-N.
| Molecular formula | C24H19NO4 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonyl)-1,3-dihydroisoindole-5-carboxylic acid |
| InChIKey | LLDDMZGYILWGLP-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)