CAS 98818-34-9 appears in our catalog under these names: Erythro-N-Boc-D-phenylalanine Epoxide, E658518. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
Tert-butyl N-[(1R)-1-[(2R)-oxiran-2-yl]-2-phenylethyl]carbamate (CAS 98818-34-9) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: tert-butyl N-[(1R)-1-[(2R)-oxiran-2-yl]-2-phenylethyl]carbamate. InChIKey: NVPOUMXZERMIJK-OLZOCXBDSA-N.
| Molecular formula | C15H21NO3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-[(2R)-oxiran-2-yl]-2-phenylethyl]carbamate |
| InChIKey | NVPOUMXZERMIJK-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1)[C@@H]2CO2 |
Computed by PubChem (NCBI)