CAS 1565054-28-5 appears in our catalog under these names: 2-Fluoro-4-hydroxy-5-nitrobenzoic acid, 96%, 2-Fluoro-4-hydroxy-5-nitrobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
2-fluoro-4-hydroxy-5-nitrobenzoic acid (CAS 1565054-28-5) is a chemical compound with the molecular formula C7H4FNO5 and a molecular weight of 201.11 g/mol. IUPAC name: 2-fluoro-4-hydroxy-5-nitrobenzoic acid. InChIKey: MIYOJWIYWUTYKP-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO5 |
|---|---|
| Molecular weight | 201.11 g/mol |
| IUPAC name | 2-fluoro-4-hydroxy-5-nitrobenzoic acid |
| InChIKey | MIYOJWIYWUTYKP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])O)F)C(=O)O |
Computed by PubChem (NCBI)