Products 2386628-50-6
CAS 2386628-50-6 is the registry number for 2-Fluoro-3-hydroxy-6-nitrobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-3-hydroxy-6-nitrobenzoic acid (CAS 2386628-50-6) is a chemical compound with the molecular formula C7H4FNO5 and a molecular weight of 201.11 g/mol. IUPAC name: 2-fluoro-3-hydroxy-6-nitrobenzoic acid. InChIKey: RGDPUPHRNXTYHW-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO5 |
|---|---|
| Molecular weight | 201.11 g/mol |
| IUPAC name | 2-fluoro-3-hydroxy-6-nitrobenzoic acid |
| InChIKey | RGDPUPHRNXTYHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])C(=O)O)F)O |
Computed by PubChem (NCBI)
Synonyms:
2-Fluoro-3-hydroxy-6-nitrobenzoic acid