Products 1820639-38-0
CAS 1820639-38-0 appears in our catalog under these names: 6-Fluoro-2-hydroxy-3-nitrobenzoic acid, 95%, 6-Fluoro-2-hydroxy-3-nitrobenzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
6-fluoro-2-hydroxy-3-nitrobenzoic acid (CAS 1820639-38-0) is a chemical compound with the molecular formula C7H4FNO5 and a molecular weight of 201.11 g/mol. IUPAC name: 6-fluoro-2-hydroxy-3-nitrobenzoic acid. InChIKey: UERRYAMICLGJBJ-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO5 |
|---|---|
| Molecular weight | 201.11 g/mol |
| IUPAC name | 6-fluoro-2-hydroxy-3-nitrobenzoic acid |
| InChIKey | UERRYAMICLGJBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])O)C(=O)O)F |
Computed by PubChem (NCBI)