CAS 1565306-21-9 is the registry number for (S)-2-Acetamido-6-(diphenyl(p-tolyl)methylamino)hexanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
(2S)-2-acetamido-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid (CAS 1565306-21-9) is a chemical compound with the molecular formula C28H32N2O3 and a molecular weight of 444.6 g/mol. IUPAC name: (2S)-2-acetamido-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid. InChIKey: COIRIEZZTSQCIQ-SANMLTNESA-N.
| Molecular formula | C28H32N2O3 |
|---|---|
| Molecular weight | 444.6 g/mol |
| IUPAC name | (2S)-2-acetamido-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid |
| InChIKey | COIRIEZZTSQCIQ-SANMLTNESA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NCCCC[C@@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)