Products 217176-83-5
CAS 217176-83-5 appears in our catalog under these names: Dihydrorhodamine 6G, 98%, Dihydrorhodamine 6G, Dihydrorhodamine 6G, Dihydrorhodamine 6G, 98.17%, DHR 6G [DihydrorhodaMine 6G]. Offered by: AmBeed, GLPBio, TCI, MedChemExpress, Chemat. Available pack sizes: 25mg, 100mg, 10 mg, 5 mg.
Ethyl 2-[3,6-bis(ethylamino)-2,7-dimethyl-9H-xanthen-9-yl]benzoate (CAS 217176-83-5) is a chemical compound with the molecular formula C28H32N2O3 and a molecular weight of 444.6 g/mol. IUPAC name: ethyl 2-[3,6-bis(ethylamino)-2,7-dimethyl-9H-xanthen-9-yl]benzoate. InChIKey: BUJYUNAFKYHMAS-UHFFFAOYSA-N.
| Molecular formula | C28H32N2O3 |
|---|---|
| Molecular weight | 444.6 g/mol |
| IUPAC name | ethyl 2-[3,6-bis(ethylamino)-2,7-dimethyl-9H-xanthen-9-yl]benzoate |
| InChIKey | BUJYUNAFKYHMAS-UHFFFAOYSA-N |
| SMILES | CCNC1=CC2=C(C=C1C)C(C3=C(O2)C=C(C(=C3)C)NCC)C4=CC=CC=C4C(=O)OCC |
Computed by PubChem (NCBI)