Products 773823-07-7
CAS 773823-07-7 appears in our catalog under these names: tert-Butyl N5-trityl-L-glutaminate, 95%, tert-butyl (2S)-2-amino-5-oxo-5-(tritylamino)pentanoate, 96%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 10g, 25g.
Tert-butyl (2S)-2-amino-5-oxo-5-(tritylamino)pentanoate (CAS 773823-07-7) is a chemical compound with the molecular formula C28H32N2O3 and a molecular weight of 444.6 g/mol. IUPAC name: tert-butyl (2S)-2-amino-5-oxo-5-(tritylamino)pentanoate. InChIKey: RLGWDIMMYJZIMR-DEOSSOPVSA-N.
| Molecular formula | C28H32N2O3 |
|---|---|
| Molecular weight | 444.6 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-5-oxo-5-(tritylamino)pentanoate |
| InChIKey | RLGWDIMMYJZIMR-DEOSSOPVSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC(=O)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)