Products 1565731-73-8

CAS 1565731-73-8 is the registry number for 2,2-Dimethylbutane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

2,2-Dimethylbutane-1-sulfonyl chloride
Biosynth
  • size: 50mg, 0,5g
  • Variants: 2
View product
Structural formula: {0} (CAS {1})

2,2-dimethylbutane-1-sulfonyl chloride (CAS 1565731-73-8) is a chemical compound with the molecular formula C6H13ClO2S and a molecular weight of 184.69 g/mol. IUPAC name: 2,2-dimethylbutane-1-sulfonyl chloride. InChIKey: NGKGZIQMXJYFLI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H13ClO2S
Molecular weight184.69 g/mol
IUPAC name2,2-dimethylbutane-1-sulfonyl chloride
InChIKeyNGKGZIQMXJYFLI-UHFFFAOYSA-N
SMILESCCC(C)(C)CS(=O)(=O)Cl

Computed by PubChem (NCBI)

Synonyms: 2,2-dimethylbutane-1-sulfonyl chloride, 2,2-dimethylbutane-1-sulfonylchloride
Isomers (same molecular formula)
hexane-1-sulfonyl chloride C6H13ClO2S
2,3-dimethylbutane-1-sulfonyl chloride C6H13ClO2S
4-methylpentane-2-sulfonyl chloride C6H13ClO2S
hexane-3-sulfonyl chloride C6H13ClO2S
hexane-2-sulfonyl chloride C6H13ClO2S
4-methylpentane-1-sulfonyl chloride C6H13ClO2S