Products 78429-90-0

CAS 78429-90-0 appears in our catalog under these names: 4-Methylpentane-2-sulfonyl chloride, 95%, 4-Methylpentane-2-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

4-methylpentane-2-sulfonyl chloride (CAS 78429-90-0) is a chemical compound with the molecular formula C6H13ClO2S and a molecular weight of 184.69 g/mol. IUPAC name: 4-methylpentane-2-sulfonyl chloride. InChIKey: UDICPXQQCPKMFG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H13ClO2S
Molecular weight184.69 g/mol
IUPAC name4-methylpentane-2-sulfonyl chloride
InChIKeyUDICPXQQCPKMFG-UHFFFAOYSA-N
SMILESCC(C)CC(C)S(=O)(=O)Cl

Computed by PubChem (NCBI)