Products 75315-32-1

CAS 75315-32-1 appears in our catalog under these names: 2,3-Dimethylbutane-1-sulfonyl chloride, 2,3-Dimethylbutane-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.

2,3-dimethylbutane-1-sulfonyl chloride (CAS 75315-32-1) is a chemical compound with the molecular formula C6H13ClO2S and a molecular weight of 184.69 g/mol. IUPAC name: 2,3-dimethylbutane-1-sulfonyl chloride. InChIKey: MIOSINMTJQXFPB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H13ClO2S
Molecular weight184.69 g/mol
IUPAC name2,3-dimethylbutane-1-sulfonyl chloride
InChIKeyMIOSINMTJQXFPB-UHFFFAOYSA-N
SMILESCC(C)C(C)CS(=O)(=O)Cl

Computed by PubChem (NCBI)