CAS 1566588-55-3 is the registry number for 3-(3,4-Dimethylphenyl)pyrazin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,4-dimethylphenyl)-1H-pyrazin-2-one (CAS 1566588-55-3) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: 3-(3,4-dimethylphenyl)-1H-pyrazin-2-one. InChIKey: BDFWEGAIVFCHKX-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 3-(3,4-dimethylphenyl)-1H-pyrazin-2-one |
| InChIKey | BDFWEGAIVFCHKX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NC=CNC2=O)C |
Computed by PubChem (NCBI)