CAS 156692-01-2 appears in our catalog under these names: 1-(3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydro-naphthalen-2-yl)-ethanol, 95%, 1–(3,5,5,8,8–Pentamethyl–5,6,7,8–tetrahydronaphthalen–2–yl)ethan–1–ol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethanol (CAS 156692-01-2) is a chemical compound with the molecular formula C17H26O and a molecular weight of 246.4 g/mol. IUPAC name: 1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethanol. InChIKey: XNMMWZBUYZDJOL-UHFFFAOYSA-N.
| Molecular formula | C17H26O |
|---|---|
| Molecular weight | 246.4 g/mol |
| IUPAC name | 1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethanol |
| InChIKey | XNMMWZBUYZDJOL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(C)O)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)