CAS 2234-14-2 appears in our catalog under these names: 1-(2,4,6-Triisopropylphenyl)ethan-1-one 99%, 1-[2,4,6-Tris(1-methylethyl)phenyl]ethanone, 99%, 99%. Offered by: Ambeed, Chemat. Available pack sizes: 5g, 25g, 100g.
1-[2,4,6-tri(propan-2-yl)phenyl]ethanone (CAS 2234-14-2) is a chemical compound with the molecular formula C17H26O and a molecular weight of 246.4 g/mol. IUPAC name: 1-[2,4,6-tri(propan-2-yl)phenyl]ethanone. InChIKey: SGRDDUKVLKWIBZ-UHFFFAOYSA-N.
| Molecular formula | C17H26O |
|---|---|
| Molecular weight | 246.4 g/mol |
| IUPAC name | 1-[2,4,6-tri(propan-2-yl)phenyl]ethanone |
| InChIKey | SGRDDUKVLKWIBZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C(=O)C)C(C)C |
Computed by PubChem (NCBI)