Products 255836-56-7
CAS 255836-56-7 is the registry number for 2,4-Dimethyl-2-(4-tert-butylphenyl)-3-pentanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-(4-tert-butylphenyl)-2,4-dimethylpentan-3-one (CAS 255836-56-7) is a chemical compound with the molecular formula C17H26O and a molecular weight of 246.4 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-2,4-dimethylpentan-3-one. InChIKey: XPPBTWHNMSTPAF-UHFFFAOYSA-N.
| Molecular formula | C17H26O |
|---|---|
| Molecular weight | 246.4 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-2,4-dimethylpentan-3-one |
| InChIKey | XPPBTWHNMSTPAF-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C(C)(C)C1=CC=C(C=C1)C(C)(C)C |
Computed by PubChem (NCBI)