Products 1567669-01-5
CAS 1567669-01-5 is the registry number for Ethyl (2Z)-3-(5-bromofuran-2-yl)-2-methylprop-2-enoate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Ethyl (Z)-3-(5-bromofuran-2-yl)-2-methylprop-2-enoate (CAS 1567669-01-5) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: ethyl (Z)-3-(5-bromofuran-2-yl)-2-methylprop-2-enoate. InChIKey: GAGWQMYKBGXUJD-SREVYHEPSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | ethyl (Z)-3-(5-bromofuran-2-yl)-2-methylprop-2-enoate |
| InChIKey | GAGWQMYKBGXUJD-SREVYHEPSA-N |
| SMILES | CCOC(=O)/C(=C\C1=CC=C(O1)Br)/C |
Computed by PubChem (NCBI)