CAS 1567986-85-9 appears in our catalog under these names: (4S)-6,8-dimethyl-3,4-dihydro-2h-1-benzopyran-4-ol, 95%, (4S)-6,8-Dimethyl-3,4-dihydro-2H-1-benzopyran-4-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(4S)-6,8-dimethyl-3,4-dihydro-2H-chromen-4-ol (CAS 1567986-85-9) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: (4S)-6,8-dimethyl-3,4-dihydro-2H-chromen-4-ol. InChIKey: JCOKVBOJMBLIJT-JTQLQIEISA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | (4S)-6,8-dimethyl-3,4-dihydro-2H-chromen-4-ol |
| InChIKey | JCOKVBOJMBLIJT-JTQLQIEISA-N |
| SMILES | CC1=CC(=C2C(=C1)[C@H](CCO2)O)C |
Computed by PubChem (NCBI)