CAS 1568-70-3 appears in our catalog under these names: 4–Methoxy–2–nitrophenol, 4-Methoxy-2-nitrophenol, 4-Methoxy-2-nitrophenol, >98.0%(GC)(T), 4-Methoxy-2-nitrophenol 98%, 4-Methoxy-2-nitrophenol, 98%, 98%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 100g, 250g, 25g, 500g, 50g, 5g, 10g, 1g.
4-methoxy-2-nitrophenol (CAS 1568-70-3) is a chemical compound with the molecular formula C7H7NO4 and a molecular weight of 169.13 g/mol. IUPAC name: 4-methoxy-2-nitrophenol. InChIKey: YBUGOACXDPDUIR-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4 |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 4-methoxy-2-nitrophenol |
| InChIKey | YBUGOACXDPDUIR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)